EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO5 |
| Net Charge | 0 |
| Average Mass | 313.309 |
| Monoisotopic Mass | 313.09502 |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccccc2C(=O)O)ccc1O |
| InChI | InChI=1S/C17H15NO5/c1-23-15-10-11(6-8-14(15)19)7-9-16(20)18-13-5-3-2-4-12(13)17(21)22/h2-10,19H,1H3,(H,18,20)(H,21,22)/b9-7+ |
| InChIKey | FSKJPXSYWQUVGO-VQHVLOKHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Avenanthramide E (CHEBI:174266) is a alkaloid (CHEBI:22315) |
| Avenanthramide E (CHEBI:174266) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| 2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8420534 | ChemSpider |
| HMDB0029283 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:93755-77-2 | ChemIDplus |