EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O4 |
| Net Charge | 0 |
| Average Mass | 242.230 |
| Monoisotopic Mass | 242.05791 |
| SMILES | Oc1cc(O)c2c(ccc3ccc(O)c(O)c32)c1 |
| InChI | InChI=1S/C14H10O4/c15-9-5-8-2-1-7-3-4-10(16)14(18)13(7)12(8)11(17)6-9/h1-6,15-18H |
| InChIKey | JSLUYTKYLIDAEB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,5,6-Phenanthrenetetrol (CHEBI:174250) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| phenanthrene-2,4,5,6-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 30776955 | ChemSpider |
| HMDB0032866 | HMDB |