EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O5S |
| Net Charge | 0 |
| Average Mass | 238.265 |
| Monoisotopic Mass | 238.06234 |
| SMILES | N[C@@H](CCS(=O)C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H14N2O5S/c8-4(6(10)11)1-2-15(14)3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-,15?/m0/s1 |
| InChIKey | JNUGGJHCMRWUDV-FMMPLYQGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cystathionine sulfoxide (CHEBI:174226) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-[(2R)-2-amino-2-carboxyethyl]sulinylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 149828 | ChemSpider |
| HMDB0002399 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:54927-81-0 | ChemIDplus |