EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO2 |
| Net Charge | 0 |
| Average Mass | 309.409 |
| Monoisotopic Mass | 309.17288 |
| SMILES | COc1cc(CCN(C)C)c2ccc3ccccc3c2c1OC |
| InChI | InChI=1S/C20H23NO2/c1-21(2)12-11-15-13-18(22-3)20(23-4)19-16-8-6-5-7-14(16)9-10-17(15)19/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | UZZFAUDNCIFFPM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Atherosperminine (CHEBI:174220) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenanthren-1-yl)-N,N-dimethylethanamine |
| Manual Xrefs | Databases |
|---|---|
| 87510 | ChemSpider |
| HMDB0030304 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:5531-98-6 | ChemIDplus |