EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O5 |
| Net Charge | 0 |
| Average Mass | 226.228 |
| Monoisotopic Mass | 226.08412 |
| SMILES | COc1cc(CCC(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H14O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h5-6,14H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | BPPVOXVSMSXBEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrosinapic acid (CHEBI:174167) is a benzenes (CHEBI:22712) |
| Dihydrosinapic acid (CHEBI:174167) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| dihydrosinapate (CHEBI:747476) is conjugate base of Dihydrosinapic acid (CHEBI:174167) |
| IUPAC Name |
|---|
| 3-(4-hydroxy-3,5-dimethoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 76391 | ChemSpider |
| HMDB0041727 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:14897-78-0 | ChemIDplus |