EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | COc1cc(C(=O)O)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C10H10O6/c1-15-7-3-5(9(11)12)6(10(13)14)4-8(7)16-2/h3-4H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | SKBDLRWFSRLIPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-Dimethoxy-1,2-benzenedicarboxylic acid (CHEBI:174164) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 4,5-dimethoxyphthalic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033893 | HMDB |
| 256696 | ChemSpider |