EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12N2O |
| Net Charge | 0 |
| Average Mass | 224.263 |
| Monoisotopic Mass | 224.09496 |
| SMILES | C=Cc1nccc2c3ccccc3n(OC)c12 |
| InChI | InChI=1S/C14H12N2O/c1-3-12-14-11(8-9-15-12)10-6-4-5-7-13(10)16(14)17-2/h3-9H,1H2,2H3 |
| InChIKey | CXIOSEMXFPKHOB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Methoxy-1-vinyl-beta-carboline (CHEBI:174150) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-ethenyl-9-methoxypyrido[3,4-b]indole |
| Manual Xrefs | Databases |
|---|---|
| 555011 | ChemSpider |
| HMDB0030379 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:69355-01-7 | ChemIDplus |