EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O4 |
| Net Charge | 0 |
| Average Mass | 130.099 |
| Monoisotopic Mass | 130.02661 |
| SMILES | [H]C(=O)CCC(=O)C(=O)O |
| InChI | InChI=1S/C5H6O4/c6-3-1-2-4(7)5(8)9/h3H,1-2H2,(H,8,9) |
| InChIKey | VHKNBDIQDAXGBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dioxopentanoic acid (CHEBI:17415) has functional parent valeric acid (CHEBI:17418) |
| 2,5-dioxopentanoic acid (CHEBI:17415) is a aldehyde (CHEBI:17478) |
| 2,5-dioxopentanoic acid (CHEBI:17415) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 2,5-dioxopentanoic acid (CHEBI:17415) is conjugate acid of 2,5-dioxopentanoate (CHEBI:58136) |
| Incoming Relation(s) |
| 2,5-dioxopentanoate (CHEBI:58136) is conjugate base of 2,5-dioxopentanoic acid (CHEBI:17415) |
| IUPAC Name |
|---|
| 2,5-dioxopentanoic acid |
| Synonyms | Source |
|---|---|
| 2,5-Dioxopentanoate | KEGG COMPOUND |
| 2-Oxoglutarate semialdehyde | KEGG COMPOUND |