EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O2 |
| Net Charge | 0 |
| Average Mass | 296.410 |
| Monoisotopic Mass | 296.17763 |
| SMILES | COC(CCc1ccccc1)CC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-22-20(15-13-18-10-6-3-7-11-18)16-19(21)14-12-17-8-4-2-5-9-17/h2-11,20H,12-16H2,1H3 |
| InChIKey | PVYORFBABSDDNC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Methoxy-1,7-diphenyl-3-heptanone (CHEBI:174142) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 5-methoxy-1,7-diphenylheptan-3-one |
| Manual Xrefs | Databases |
|---|---|
| 4477729 | ChemSpider |
| HMDB0033293 | HMDB |