EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O4 |
| Net Charge | 0 |
| Average Mass | 296.282 |
| Monoisotopic Mass | 296.07971 |
| SMILES | COc1c(O)c(=O)n2c3ccccc3c3cc(=O)n(C)c1c32 |
| InChI | InChI=1S/C16H12N2O4/c1-17-11(19)7-9-8-5-3-4-6-10(8)18-12(9)13(17)15(22-2)14(20)16(18)21/h3-7,20H,1-2H3 |
| InChIKey | CQFOPDQAOBCODL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-Hydroxy-4-methoxy-3-methyl-2,6-canthinedione (CHEBI:174129) is a alkaloid (CHEBI:22315) |
| 5-Hydroxy-4-methoxy-3-methyl-2,6-canthinedione (CHEBI:174129) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 3-hydroxy-4-methoxy-6-methyl-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),8,10,12,14-hexaene-2,7-dione |
| Manual Xrefs | Databases |
|---|---|
| 30777512 | ChemSpider |
| HMDB0040798 | HMDB |