EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2O4 |
| Net Charge | 0 |
| Average Mass | 296.282 |
| Monoisotopic Mass | 296.07971 |
| SMILES | Oc1cc2ncc(-c3cnc4cc(O)c(O)cc34)c2cc1O |
| InChI | InChI=1S/C16H12N2O4/c19-13-1-7-9(5-17-11(7)3-15(13)21)10-6-18-12-4-16(22)14(20)2-8(10)12/h1-6,17-22H |
| InChIKey | UHYVKNUCMCSKMR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beta vulgaris (ncbitaxon:161934) | - | PubMed (11724374) | Isolated from peel extract. |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5',6,6'-tetrahydroxy-3,3'-biindolyl (CHEBI:174128) has role antioxidant (CHEBI:22586) |
| 5,5',6,6'-tetrahydroxy-3,3'-biindolyl (CHEBI:174128) has role plant metabolite (CHEBI:76924) |
| 5,5',6,6'-tetrahydroxy-3,3'-biindolyl (CHEBI:174128) is a biindole alkaloid (CHEBI:167888) |
| 5,5',6,6'-tetrahydroxy-3,3'-biindolyl (CHEBI:174128) is a hydroxyindoles (CHEBI:84729) |
| 5,5',6,6'-tetrahydroxy-3,3'-biindolyl (CHEBI:174128) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| 1H,1'H-[3,3'-biindole]-5,5',6,6'-tetrol |
| Synonyms | Source |
|---|---|
| [3,3'-bi-1H-indole]-5,5',6,6'-tetrol | ChEBI |
| 3,3'-bi-1H-indole-5,5',6,6'-tetrol | KNApSAcK |
| 3-(5,6-dihydroxy-1H-indol-3-yl)-1H-indole-5,6-diol | SUBMITTER |
| 5,5',6,6'-tetrahydroxy-3,3'-bi-1H-indole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 10209313 | ChemSpider |
| C00054813 | KNApSAcK |
| EP3148648 | Patent |
| HMDB0029301 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:390401-91-9 | ChEBI |
| Citations |
|---|