EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO4 |
| Net Charge | 0 |
| Average Mass | 221.212 |
| Monoisotopic Mass | 221.06881 |
| SMILES | COC(=O)CC1C(=O)Nc2ccc(O)cc21 |
| InChI | InChI=1S/C11H11NO4/c1-16-10(14)5-8-7-4-6(13)2-3-9(7)12-11(8)15/h2-4,8,13H,5H2,1H3,(H,12,15) |
| InChIKey | PQPVNWBNDOFPBO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 5-hydroxyoxindole-3-acetate (CHEBI:174122) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl 2-(5-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetate |
| Manual Xrefs | Databases |
|---|---|
| 35014707 | ChemSpider |
| HMDB0038990 | HMDB |