EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19NO2 |
| Net Charge | 0 |
| Average Mass | 293.366 |
| Monoisotopic Mass | 293.14158 |
| SMILES | COc1cc2c3c(cc4ccccc4c3c1OC)N(C)CC2 |
| InChI | InChI=1S/C19H19NO2/c1-20-9-8-13-11-16(21-2)19(22-3)18-14-7-5-4-6-12(14)10-15(20)17(13)18/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | JBGSWIBJAGBGOP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dehydronuciferine (CHEBI:174097) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033737 | HMDB |
| 717588 | ChemSpider |