EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H12O5/c1-15-9(10(13)14)5-6-2-3-7(11)8(12)4-6/h2-4,9,11-12H,5H2,1H3,(H,13,14) |
| InChIKey | YNFNAIPTIVRKBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-Dihydroxyphenyl)-2-methoxypropionic acid (CHEBI:174082) is a benzenes (CHEBI:22712) |
| 3-(3,4-Dihydroxyphenyl)-2-methoxypropionic acid (CHEBI:174082) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-2-methoxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35015213 | ChemSpider |
| HMDB0041663 | HMDB |