EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COc1cc(CC(C)C(=O)O)ccc1O |
| InChI | InChI=1S/C11H14O4/c1-7(11(13)14)5-8-3-4-9(12)10(6-8)15-2/h3-4,6-7,12H,5H2,1-2H3,(H,13,14) |
| InChIKey | XUQXZROVMZNKPO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-Hydroxy-3-methoxyphenyl)-2-methylpropionic acid (CHEBI:174057) is a benzenes (CHEBI:22712) |
| 3-(4-Hydroxy-3-methoxyphenyl)-2-methylpropionic acid (CHEBI:174057) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(4-hydroxy-3-methoxyphenyl)-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21405417 | ChemSpider |
| HMDB0060737 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53832-93-2 | ChemIDplus |