EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14O4 |
| Net Charge | 0 |
| Average Mass | 210.229 |
| Monoisotopic Mass | 210.08921 |
| SMILES | COc1ccc(CC(OC)C(=O)O)cc1 |
| InChI | InChI=1S/C11H14O4/c1-14-9-5-3-8(4-6-9)7-10(15-2)11(12)13/h3-6,10H,7H2,1-2H3,(H,12,13) |
| InChIKey | OGJKUGGZOYNPSS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methoxy-3-(4-methoxyphenyl)propanoic acid (CHEBI:174055) is a benzenes (CHEBI:22712) |
| 2-Methoxy-3-(4-methoxyphenyl)propanoic acid (CHEBI:174055) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2-methoxy-3-(4-methoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28943429 | ChemSpider |
| HMDB0039428 | HMDB |