EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO3 |
| Net Charge | 0 |
| Average Mass | 287.359 |
| Monoisotopic Mass | 287.15214 |
| SMILES | CN1CCC23c4c5ccc(O)c4OC2[C@@H](O)CCC3C1C5 |
| InChI | InChI=1S/C17H21NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2,4,10-11,13,16,19-20H,3,5-8H2,1H3/t10?,11?,13-,16?,17?/m0/s1 |
| InChIKey | IJVCSMSMFSCRME-LIBMUZAMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6alpha-Hydroxy-hydromorphone (CHEBI:174042) is a morphinane alkaloid (CHEBI:25418) |
| IUPAC Name |
|---|
| (7S)-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzouro[3,2-e]isoquinoline-7,9-diol |
| Manual Xrefs | Databases |
|---|---|
| 35031791 | ChemSpider |
| HMDB0060796 | HMDB |