EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10O4 |
| Net Charge | 0 |
| Average Mass | 206.197 |
| Monoisotopic Mass | 206.05791 |
| SMILES | C=COC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H10O4/c1-2-15-11(14)6-4-8-3-5-9(12)10(13)7-8/h2-7,12-13H,1H2/b6-4+ |
| InChIKey | XVCVDNKCUNGTRP-GQCTYLIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vinyl caffeate (CHEBI:174026) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| ethenyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 9302539 | ChemSpider |
| HMDB0029775 | HMDB |