EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4 |
| Net Charge | 0 |
| Average Mass | 202.250 |
| Monoisotopic Mass | 202.12051 |
| SMILES | CC[C@@H](C)[C@H](CC(=O)[C@H](C)O)C(=O)O |
| InChI | InChI=1S/C10H18O4/c1-4-6(2)8(10(13)14)5-9(12)7(3)11/h6-8,11H,4-5H2,1-3H3,(H,13,14)/t6-,7+,8+/m1/s1 |
| InChIKey | DYYQDDUCQLULFE-CSMHCCOUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-lactoyl-Isoeucine (CHEBI:174013) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (2S,5S)-2-[(2R)-butan-2-yl]-5-hydroxy-4-oxohexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 59664335 | ChemSpider |
| HMDB0062180 | HMDB |