EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2 |
| Net Charge | 0 |
| Average Mass | 282.431 |
| Monoisotopic Mass | 282.20960 |
| SMILES | CCC12CCCN3CCC4(c5ccccc5NC4CC1)C32 |
| InChI | InChI=1S/C19H26N2/c1-2-18-9-5-12-21-13-11-19(17(18)21)14-6-3-4-7-15(14)20-16(19)8-10-18/h3-4,6-7,16-17,20H,2,5,8-13H2,1H3 |
| InChIKey | YAAIPCQYJYPITK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-Aspidospermidine (CHEBI:174012) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| 12-ethyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-triene |
| Manual Xrefs | Databases |
|---|---|
| 8260738 | ChemSpider |
| HMDB0030360 | HMDB |