EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O2 |
| Net Charge | 0 |
| Average Mass | 282.383 |
| Monoisotopic Mass | 282.16198 |
| SMILES | Oc1ccc(CCC(O)CC/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O2/c20-18(13-10-17-11-14-19(21)15-12-17)9-5-4-8-16-6-2-1-3-7-16/h1-4,6-8,11-12,14-15,18,20-21H,5,9-10,13H2/b8-4+ |
| InChIKey | PXPIJNMPDAFWSF-XBXARRHUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-(E)-1-(4-Hydroxyphenyl)-7-phenyl-6-hepten-3-ol (CHEBI:174010) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| 4-[(E)-3-hydroxy-7-phenylhept-6-enyl]phenol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041090 | HMDB |
| 8214993 | ChemSpider |