EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | O=C(CO)[C@H](O)[C@@H](O)CO |
| WURCS | WURCS=2.0/1,1,0/[hO21h]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h3,5-8,10H,1-2H2/t3-,5+/m0/s1 |
| InChIKey | ZAQJHHRNXZUBTE-WVZVXSGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-xylulose (CHEBI:17399) has role Escherichia coli metabolite (CHEBI:76971) |
| L-xylulose (CHEBI:17399) has role human metabolite (CHEBI:77746) |
| L-xylulose (CHEBI:17399) has role mouse metabolite (CHEBI:75771) |
| L-xylulose (CHEBI:17399) is a xylulose (CHEBI:27353) |
| L-xylulose (CHEBI:17399) is enantiomer of D-xylulose (CHEBI:17140) |
| Incoming Relation(s) |
| L-xylulose 1-phosphate (CHEBI:28566) has functional parent L-xylulose (CHEBI:17399) |
| L-xylulose 5-phosphate (CHEBI:16593) has functional parent L-xylulose (CHEBI:17399) |
| D-xylulose (CHEBI:17140) is enantiomer of L-xylulose (CHEBI:17399) |
| IUPAC Name |
|---|
| L-xylulose |
| Synonyms | Source |
|---|---|
| L-Lyxulose | KEGG COMPOUND |
| L-threo-Pentulose | KEGG COMPOUND |
| L-Xylulose | KEGG COMPOUND |
| L-threo-pent-2-ulose | IUPAC |
| L-Xul | JCBN |
| UniProt Name | Source |
|---|---|
| L-xylulose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00312 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:527-50-4 | KEGG COMPOUND |