EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | CC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C10H12O4/c1-6(10(13)14)4-7-2-3-8(11)9(12)5-7/h2-3,5-6,11-12H,4H2,1H3,(H,13,14) |
| InChIKey | GIIOASILGOFVPI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-Dihydroxyphenyl)-2-methylpropionic acid (CHEBI:173974) is a benzenes (CHEBI:22712) |
| 3-(3,4-Dihydroxyphenyl)-2-methylpropionic acid (CHEBI:173974) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060735 | HMDB |
| 15588229 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53832-94-3 | ChemIDplus |