EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O4 |
| Net Charge | 0 |
| Average Mass | 196.202 |
| Monoisotopic Mass | 196.07356 |
| SMILES | COc1ccc(OC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C10H12O4/c1-7(10(11)12)14-9-5-3-8(13-2)4-6-9/h3-7H,1-2H3,(H,11,12) |
| InChIKey | MIEKOFWWHVOKQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-(4-Methoxyphenoxy)propanoic acid (CHEBI:173971) is a aromatic ether (CHEBI:35618) |
| (S)-2-(4-Methoxyphenoxy)propanoic acid (CHEBI:173971) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-(4-methoxyphenoxy)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040256 | HMDB |
| 133262 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:13794-15-5 | ChemIDplus |