EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | COc1cc(C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C9H8O5/c1-12-6-2-5(9(10)11)3-7-8(6)14-4-13-7/h2-3H,4H2,1H3,(H,10,11) |
| InChIKey | AOHAPDDBNAPPIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methoxy-4,5-methylenedioxybenzoic acid (CHEBI:173960) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| 7-methoxy-1,3-benzodioxole-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 527906 | ChemSpider |
| HMDB0030800 | HMDB |