EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O |
| Net Charge | 0 |
| Average Mass | 264.368 |
| Monoisotopic Mass | 264.15142 |
| SMILES | OC(/C=C/C=C\c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-14,19-20H,15-16H2/b13-7-,14-8+ |
| InChIKey | OVURIZIJDDTXJS-MFUUIURDSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-1,7-Diphenyl-4,6-heptadien-3-ol (CHEBI:173879) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (4E,6Z)-1,7-diphenylhepta-4,6-dien-3-ol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040893 | HMDB |
| 35015042 | ChemSpider |