EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | O=C(O)C(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C9H10O4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,7-8,10-11H,(H,12,13) |
| InChIKey | BNOUUNAFHCJIJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Hydroxyphenyllactate (CHEBI:173869) is a benzenes (CHEBI:22712) |
| 3-Hydroxyphenyllactate (CHEBI:173869) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 2,3-dihydroxy-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029232 | HMDB |
| 233533 | ChemSpider |