EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O3 |
| Net Charge | 0 |
| Average Mass | 180.203 |
| Monoisotopic Mass | 180.07864 |
| SMILES | CC(Cc1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C10H12O3/c1-7(10(12)13)5-8-3-2-4-9(11)6-8/h2-4,6-7,11H,5H2,1H3,(H,12,13) |
| InChIKey | ZTHRBJCNTAYZRE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3-Hydroxyphenyl)-2-methylpropionic acid (CHEBI:173861) is a benzenes (CHEBI:22712) |
| 3-(3-Hydroxyphenyl)-2-methylpropionic acid (CHEBI:173861) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-(3-hydroxyphenyl)-2-methylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 19077294 | ChemSpider |
| HMDB0060734 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:46207-82-3 | ChemIDplus |