EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO3S |
| Net Charge | 0 |
| Average Mass | 179.241 |
| Monoisotopic Mass | 179.06161 |
| SMILES | CCCS(=O)CC(N)C(=O)O |
| InChI | InChI=1S/C6H13NO3S/c1-2-3-11(10)4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9) |
| InChIKey | JZKMSAGUCSIIAH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)C(R)S-S-Propylcysteine sulfoxide (CHEBI:173840) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-propylsulinylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029442 | HMDB |
| 311305 | ChemSpider |