EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3S |
| Net Charge | 0 |
| Average Mass | 177.225 |
| Monoisotopic Mass | 177.04596 |
| SMILES | CC1CS(=O)CC(C(=O)O)N1 |
| InChI | InChI=1S/C6H11NO3S/c1-4-2-11(10)3-5(7-4)6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9) |
| InChIKey | JYMHODZXTIGVPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cycloalliin (CHEBI:173815) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 5-methyl-1-oxo-1,4-thiazinane-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029417 | HMDB |
| 19100864 | ChemSpider |