EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N2O5 |
| Net Charge | 0 |
| Average Mass | 176.128 |
| Monoisotopic Mass | 176.04332 |
| SMILES | NC(CNC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C5H8N2O5/c6-2(4(9)10)1-7-3(8)5(11)12/h2H,1,6H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | NEEQFPMRODQIKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-Amino-3-(oxalylamino)propanoic acid (CHEBI:173808) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-3-(oxaloamino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2270 | ChemSpider |
| HMDB0029402 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7554-90-7 | ChemIDplus |