EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO5 |
| Net Charge | 0 |
| Average Mass | 175.140 |
| Monoisotopic Mass | 175.04807 |
| SMILES | CC(NC(=O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO5/c1-3(6(11)12)7-4(8)2-5(9)10/h3H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | AZKKNWAHCAZDCU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-N-(Carboxyacetyl)alanine (CHEBI:173805) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 3-(1-carboxyethylamino)-3-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 13634414 | ChemSpider |
| HMDB0039163 | HMDB |