EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O3 |
| Net Charge | 0 |
| Average Mass | 250.298 |
| Monoisotopic Mass | 250.13174 |
| SMILES | NCCC(O)CNC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C13H18N2O3/c14-8-7-12(17)9-15-13(18)6-3-10-1-4-11(16)5-2-10/h1-6,12,16-17H,7-9,14H2,(H,15,18)/b6-3+ |
| InChIKey | XBVRGBGSLROQIA-ZZXKWVIFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Coumaroyl-2-hydroxyputrescine (CHEBI:173781) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-N-(4-amino-2-hydroxybutyl)-3-(4-hydroxyphenyl)prop-2-enamide |
| Manual Xrefs | Databases |
|---|---|
| 35013608 | ChemSpider |
| HMDB0033462 | HMDB |