EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | COC(=O)c1ccccc1OC |
| InChI | InChI=1S/C9H10O3/c1-11-8-6-4-3-5-7(8)9(10)12-2/h3-6H,1-2H3 |
| InChIKey | PFYHAAAQPNMZHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl 2-methoxybenzoate (CHEBI:173749) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| methyl 2-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0032605 | HMDB |
| 21171488 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:606-45-1 | ChemIDplus |