EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO3 |
| Net Charge | 0 |
| Average Mass | 159.185 |
| Monoisotopic Mass | 159.08954 |
| SMILES | O=C(O)C1CCN1CCCO |
| InChI | InChI=1S/C7H13NO3/c9-5-1-3-8-4-2-6(8)7(10)11/h6,9H,1-5H2,(H,10,11) |
| InChIKey | ROVDTLLPFWAZJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Medicanine (CHEBI:173686) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 1-(3-hydroxypropyl)azetidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038625 | HMDB |
| 35014619 | ChemSpider |