EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO3 |
| Net Charge | 0 |
| Average Mass | 159.185 |
| Monoisotopic Mass | 159.08954 |
| SMILES | [H][C@]12CC[C@@H](O)[C@](O)(N1)[C@H](O)C2 |
| InChI | InChI=1S/C7H13NO3/c9-5-2-1-4-3-6(10)7(5,11)8-4/h4-6,8-11H,1-3H2/t4-,5-,6-,7-/m1/s1 |
| InChIKey | YOBNKFROEGVQPW-DBRKOABJSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calystegine A6 (CHEBI:173685) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| (1R,2R,5R,7R)-8-azabicyclo[3.2.1]octane-1,2,7-triol |
| Manual Xrefs | Databases |
|---|---|
| 82951791 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:177794-04-6 | ChemIDplus |