EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O3 |
| Net Charge | 0 |
| Average Mass | 158.197 |
| Monoisotopic Mass | 158.09429 |
| SMILES | CCCCCCC(=O)C(=O)O |
| InChI | InChI=1S/C8H14O3/c1-2-3-4-5-6-7(9)8(10)11/h2-6H2,1H3,(H,10,11) |
| InChIKey | GPPUPQFYDYLTIY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-oxooctanoic acid (CHEBI:173668) has functional parent octanoic acid (CHEBI:28837) |
| 2-oxooctanoic acid (CHEBI:173668) has role surfactant (CHEBI:35195) |
| 2-oxooctanoic acid (CHEBI:173668) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 2-oxooctanoic acid (CHEBI:173668) is conjugate acid of 2-oxooctanoate (CHEBI:176689) |
| Incoming Relation(s) |
| 2-oxooctanoate (CHEBI:176689) is conjugate base of 2-oxooctanoic acid (CHEBI:173668) |
| IUPAC Name |
|---|
| 2-oxooctanoic acid |
| Synonyms | Source |
|---|---|
| 2-keto-n-caprylic acid | LIPID MAPS |
| 2-oxocaprylic acid | ChEBI |
| 2-oxo-octanoic acid | LIPID MAPS |
| HMDB |
| Manual Xrefs | Databases |
|---|---|
| 60921 | ChemSpider |
| FDB029336 | FooDB |
| HMDB0013211 | HMDB |
| LMFA01060016 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1757862 | Reaxys |
| CAS:328-51-8 | ChemIDplus |
| Citations |
|---|