EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N2O4 |
| Net Charge | 0 |
| Average Mass | 224.216 |
| Monoisotopic Mass | 224.07971 |
| SMILES | NC(CC[n+]1cccc(C(=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C10H12N2O4/c11-8(10(15)16)3-5-12-4-1-2-7(6-12)9(13)14/h1-2,4,6,8H,3,5,11H2,(H-,13,14,15,16) |
| InChIKey | ZPRKDLMMZXBFPH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Nicotianine (CHEBI:173642) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 1-(3-amino-3-carboxypropyl)pyridin-1-ium-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 35032863 | ChemSpider |
| HMDB0029397 | HMDB |