EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23NO |
| Net Charge | 0 |
| Average Mass | 221.344 |
| Monoisotopic Mass | 221.17796 |
| SMILES | CC(C)=CCC/C(C)=C/CNC(=O)C1CC1 |
| InChI | InChI=1S/C14H23NO/c1-11(2)5-4-6-12(3)9-10-15-14(16)13-7-8-13/h5,9,13H,4,6-8,10H2,1-3H3,(H,15,16)/b12-9+ |
| InChIKey | UKNMSFRSBQONET-FMIVXFBMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]cyclopropanecarboxamide (CHEBI:173636) has role flavouring agent (CHEBI:35617) |
| N-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]cyclopropanecarboxamide (CHEBI:173636) is a N-(3,7-dimethylocta-2,6-dien-1-yl)cyclopropanecarboxamide (CHEBI:177880) |
| IUPAC Name |
|---|
| N-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]cyclopropanecarboxamide |
| Synonyms | Source |
|---|---|
| (2E)-N-3,7-dimethyl-2,6-octadienylcyclopropylcarboxamide | ChemIDplus |
| N-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]cyclopropanecarboxamide | ChEBI |
| N-[(2E)-3,7-dimethyl-2,6-octadienyl]cyclopropanecarboxamide | ChEBI |
| FEMA 4267 (E form) | ChEBI |
| (E)-N-3,7-dimethyl-2,6-octadienylcyclopropylcarboxamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9833352 | ChemSpider |
| FDB009327 | FooDB |
| HMDB0032240 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21687329 | Reaxys |
| CAS:744251-93-2 | ChemIDplus |
| Citations |
|---|