EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3 |
| Net Charge | 0 |
| Average Mass | 145.158 |
| Monoisotopic Mass | 145.07389 |
| SMILES | O=C(O)CN1CCOCC1 |
| InChI | InChI=1S/C6H11NO3/c8-6(9)5-7-1-3-10-4-2-7/h1-5H2,(H,8,9) |
| InChIKey | VIWZVFVJPXTXPA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-Carboxymethyl)-morpholine (CHEBI:173605) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-morpholin-4-ylacetic acid |
| Manual Xrefs | Databases |
|---|---|
| 388152 | ChemSpider |
| 00E | PDBeChem |
| HMDB0061156 | HMDB |