EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O2S |
| Net Charge | 0 |
| Average Mass | 142.179 |
| Monoisotopic Mass | 142.00885 |
| SMILES | COC(=O)c1cccs1 |
| InChI | InChI=1S/C6H6O2S/c1-8-6(7)5-3-2-4-9-5/h2-4H,1H3 |
| InChIKey | PGBFYLVIMDQYMS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl thiophene-2-carboxylate (CHEBI:173594) is a thiophenecarboxylic acid (CHEBI:48436) |
| IUPAC Name |
|---|
| methyl thiophene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 54D | PDBeChem |
| 71660 | ChemSpider |
| HMDB0029719 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:5380-42-7 | ChemIDplus |