EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8OS |
| Net Charge | 0 |
| Average Mass | 140.207 |
| Monoisotopic Mass | 140.02959 |
| SMILES | CC(=O)c1ccc(C)s1 |
| InChI | InChI=1S/C7H8OS/c1-5-3-4-7(9-5)6(2)8/h3-4H,1-2H3 |
| InChIKey | YOSDTJYMDAEEAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acetyl-5-methylthiophene (CHEBI:173589) has role flavouring agent (CHEBI:35617) |
| 2-acetyl-5-methylthiophene (CHEBI:173589) is a aromatic ketone (CHEBI:76224) |
| 2-acetyl-5-methylthiophene (CHEBI:173589) is a methyl ketone (CHEBI:51867) |
| 2-acetyl-5-methylthiophene (CHEBI:173589) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| 1-(5-methylthiophen-2-yl)ethanone |
| Synonyms | Source |
|---|---|
| 1-(5-methyl-2-thienyl)ethanone | ChemIDplus |
| 1-(5-methylthiophen-2-yl)ethan-1-one | IUPAC |
| 2-methyl-5-acetylthiophene | NIST Chemistry WebBook |
| 5-methyl-2-thienyl methyl ketone | ChEBI |
| FEMA 4643 | ChEBI |
| methyl 5-methyl-2-thienyl ketone | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 75479 | ChemSpider |
| FDB011131 | FooDB |
| HMDB0033130 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:110854 | Reaxys |
| CAS:13679-74-8 | ChemIDplus |
| CAS:13679-74-8 | NIST Chemistry WebBook |
| Citations |
|---|