EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO2 |
| Net Charge | 0 |
| Average Mass | 181.235 |
| Monoisotopic Mass | 181.11028 |
| SMILES | COc1cc(CC(C)N)ccc1O |
| InChI | InChI=1S/C10H15NO2/c1-7(11)5-8-3-4-9(12)10(6-8)13-2/h3-4,6-7,12H,5,11H2,1-2H3 |
| InChIKey | GPBOYXOSSQEJBH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-Methyl-a-methyldopamine (CHEBI:173516) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| 4-(2-aminopropyl)-2-methoxyphenol |
| Manual Xrefs | Databases |
|---|---|
| 170725 | ChemSpider |
| HMDB0060748 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:13026-44-3 | ChemIDplus |