EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H12O2 |
| Net Charge | 0 |
| Average Mass | 128.171 |
| Monoisotopic Mass | 128.08373 |
| SMILES | CC(=CC(C)C)C(=O)O |
| InChI | InChI=1S/C7H12O2/c1-5(2)4-6(3)7(8)9/h4-5H,1-3H3,(H,8,9) |
| InChIKey | DMHLGGQHOSTMJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-Dimethyl-2-pentenoic acid (CHEBI:173500) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 2,4-dimethylpent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21105881 | ChemSpider |