EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2 |
| Net Charge | 0 |
| Average Mass | 176.263 |
| Monoisotopic Mass | 176.13135 |
| SMILES | c1cnc(CC2CCCCC2)cn1 |
| InChI | InChI=1S/C11H16N2/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11/h6-7,9-10H,1-5,8H2 |
| InChIKey | DGJZDAIWCSVZBI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coffea arabica (ncbitaxon:13443) | - | PubMed (35159623) |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (cyclohexylmethyl)pyrazine (CHEBI:173485) has role flavouring agent (CHEBI:35617) |
| (cyclohexylmethyl)pyrazine (CHEBI:173485) has role plant metabolite (CHEBI:76924) |
| (cyclohexylmethyl)pyrazine (CHEBI:173485) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| 2-(cyclohexylmethyl)pyrazine |
| Synonyms | Source |
|---|---|
| 2-cyclohexylmethylpyrazine | ChEBI |
| 2-pyrazine cyclohexyl methane | ChemIDplus |
| 2-pyrazinyl cyclohexyl methane | ChemIDplus |
| (2-pyrazinylmethyl)cyclohexane | ChemIDplus |
| cyclohexylmethyl pyrazine | ChemIDplus |
| FEMA 3631 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 17332817 | ChemSpider |
| FDB015029 | FooDB |
| HMDB0036175 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:28217-92-7 | ChemIDplus |
| Citations |
|---|