EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O6 |
| Net Charge | 0 |
| Average Mass | 186.119 |
| Monoisotopic Mass | 186.01644 |
| SMILES | O=C(O)/C=C\C=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-5(9)3-1-2-4(6(10)11)7(12)13/h1-3H,(H,8,9)(H,10,11)(H,12,13)/b3-1- |
| InChIKey | SLUDRBHRUDRZJZ-IWQZZHSRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-carboxy-cis,cis-muconic acid (CHEBI:17344) is a tricarboxylic acid (CHEBI:27093) |
| 2-carboxy-cis,cis-muconic acid (CHEBI:17344) is conjugate acid of 2-carboxylato-cis,cis-muconate(3−) (CHEBI:58114) |
| Incoming Relation(s) |
| 2-carboxylato-cis,cis-muconate(3−) (CHEBI:58114) is conjugate base of 2-carboxy-cis,cis-muconic acid (CHEBI:17344) |
| IUPAC Name |
|---|
| (3Z)-buta-1,3-diene-1,1,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 2-carboxy-cis,cis-muconate | ChEBI |
| 2-Carboxy-cis,cis-muconate | KEGG COMPOUND |