EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O4 |
| Net Charge | 0 |
| Average Mass | 118.088 |
| Monoisotopic Mass | 118.02661 |
| SMILES | CC(O)C(=O)C(=O)O |
| InChI | InChI=1S/C4H6O4/c1-2(5)3(6)4(7)8/h2,5H,1H3,(H,7,8) |
| InChIKey | QWZIITCYKKSZGN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xi-3-Hydroxy-2-oxobutanoic acid (CHEBI:173438) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 3-hydroxy-2-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039324 | HMDB |
| 164189 | ChemSpider |
| LMFA01050528 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:1944-42-9 | ChemIDplus |