EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N |
| Net Charge | 0 |
| Average Mass | 163.264 |
| Monoisotopic Mass | 163.13610 |
| SMILES | CC(Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C11H17N/c1-10(12(2)3)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | OBDSVYOSYSKVMX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethylamphetamine (CHEBI:173436) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-phenylpropan-2-amine |
| Manual Xrefs | Databases |
|---|---|
| 18847 | ChemSpider |
| HMDB0041880 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:4075-96-1 | ChemIDplus |