EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO4 |
| Net Charge | 0 |
| Average Mass | 163.173 |
| Monoisotopic Mass | 163.08446 |
| SMILES | CCOCC(O)C(N)C(=O)O |
| InChI | InChI=1S/C6H13NO4/c1-2-11-3-4(8)5(7)6(9)10/h4-5,8H,2-3,7H2,1H3,(H,9,10) |
| InChIKey | HGJWTABGNGOSDZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-4-ethoxy-3-hydroxybutanoic acid (CHEBI:173427) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-4-ethoxy-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 35013510 | ChemSpider |
| HMDB0032862 | HMDB |