EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CCOC(=O)C(C)=O |
| InChI | InChI=1S/C5H8O3/c1-3-8-5(7)4(2)6/h3H2,1-2H3 |
| InChIKey | XXRCUYVCPSWGCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ethyl pyruvate (CHEBI:173421) has role cardiovascular drug (CHEBI:35554) |
| Ethyl pyruvate (CHEBI:173421) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| ethyl 2-oxopropanoate |
| Synonyms | Source |
|---|---|
| 2-oxo-propionic acid ethyl ester | ChEMBL |
| CTI-01 | ChEMBL |
| Ethyl pyruvate | ChEMBL |
| FEMA NO. 2457 | ChEMBL |
| NSC-48386 | ChEMBL |
| Pyruvic acid ethyl ester | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 11544 | ChemSpider |
| 9X7 | PDBeChem |
| DB05869 | DrugBank |
| HMDB0031643 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:617-35-6 | ChemIDplus |